|
CAS#: 73941-32-9 Product: 9-(3-Methylphenyl)-3H-Purin-6-One No suppilers available for the product. |
| Name | 9-(3-Methylphenyl)-3H-Purin-6-One |
|---|---|
| Synonyms | 6H-Purin-6-One, 1,9-Dihydro-9-(3-Methylphenyl)-; 9-(M-Tolyl)Hypoxanthine; Hypoxanthine, 9-(M-Tolyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 |
| CAS Registry Number | 73941-32-9 |
| SMILES | C2=NC1=C(NC=NC1=O)[N]2C3=CC(=CC=C3)C |
| InChI | 1S/C12H10N4O/c1-8-3-2-4-9(5-8)16-7-15-10-11(16)13-6-14-12(10)17/h2-7H,1H3,(H,13,14,17) |
| InChIKey | IILOZGWKBUXFKQ-UHFFFAOYSA-N |
| Density | 1.4g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.613°C at 760 mmHg (Cal.) |
| Flash point | 245.071°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-(3-Methylphenyl)-3H-Purin-6-One |