|
CAS#: 7403-65-8 Product: Ethyl 3-Hydroxy-2,2,4-Trimethyl-Pentanoate No suppilers available for the product. |
| Name | Ethyl 3-Hydroxy-2,2,4-Trimethyl-Pentanoate |
|---|---|
| Synonyms | 3-Hydroxy-2,2,4-Trimethylpentanoic Acid Ethyl Ester; 3-Hydroxy-2,2,4-Trimethyl-Valeric Acid Ethyl Ester; Nsc54809 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 |
| CAS Registry Number | 7403-65-8 |
| SMILES | C(C)OC(=O)C(C)(C)C(O)C(C)C |
| InChI | 1S/C10H20O3/c1-6-13-9(12)10(4,5)8(11)7(2)3/h7-8,11H,6H2,1-5H3 |
| InChIKey | XCXVWELTULZAKL-UHFFFAOYSA-N |
| Density | 0.963g/cm3 (Cal.) |
|---|---|
| Boiling point | 259.819°C at 760 mmHg (Cal.) |
| Flash point | 98.448°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-Hydroxy-2,2,4-Trimethyl-Pentanoate |