|
CAS#: 74037-36-8 Product: 2-Methylpropyl (6-Oxo-1H-Pyridazin-3-Yl) Carbonate No suppilers available for the product. |
| Name | 2-Methylpropyl (6-Oxo-1H-Pyridazin-3-Yl) Carbonate |
|---|---|
| Synonyms | Carbonic Acid Isobutyl (6-Oxo-1H-Pyridazin-3-Yl) Ester; Carbonic Acid Isobutyl (6-Keto-1H-Pyridazin-3-Yl) Ester; Isobutyl (6-Oxo-1H-Pyridazin-3-Yl) Carbonate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 |
| CAS Registry Number | 74037-36-8 |
| SMILES | C(OC(OC1=NNC(=O)C=C1)=O)C(C)C |
| InChI | 1S/C9H12N2O4/c1-6(2)5-14-9(13)15-8-4-3-7(12)10-11-8/h3-4,6H,5H2,1-2H3,(H,10,12) |
| InChIKey | KDFKXAUKGSKUAF-UHFFFAOYSA-N |
| Density | 1.292g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Methylpropyl (6-Oxo-1H-Pyridazin-3-Yl) Carbonate |