|
CAS#: 74039-40-0 Product: 1-[1-(4-Chlorophenyl)Ethyl]Pyrrolidine Hydrochloride No suppilers available for the product. |
| Name | 1-[1-(4-Chlorophenyl)Ethyl]Pyrrolidine Hydrochloride |
|---|---|
| Synonyms | (P-Chloro-Alpha-Methylbenzyl)Pyrrolidine Hydrochloride; H 376; Pyrrolidine, 1-(P-Chloro-Alpha-Methylbenzyl)-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17Cl2N |
| Molecular Weight | 246.18 |
| CAS Registry Number | 74039-40-0 |
| SMILES | [H+].C2=C(C(N1CCCC1)C)C=CC(=C2)Cl.[Cl-] |
| InChI | 1S/C12H16ClN.ClH/c1-10(14-8-2-3-9-14)11-4-6-12(13)7-5-11;/h4-7,10H,2-3,8-9H2,1H3;1H |
| InChIKey | XTAGAGFEGRYFBL-UHFFFAOYSA-N |
| Boiling point | 269.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 116.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[1-(4-Chlorophenyl)Ethyl]Pyrrolidine Hydrochloride |