|
CAS#: 74039-41-1 Product: 1-[1-(3-Chlorophenyl)Butyl]Pyrrolidine Hydrochloride No suppilers available for the product. |
| Name | 1-[1-(3-Chlorophenyl)Butyl]Pyrrolidine Hydrochloride |
|---|---|
| Synonyms | 1-(1-(M-Chlorophenyl)Butyl)Pyrrolidine Hydrochloride; H 286-M; Pyrrolidine, 1-(1-(M-Chlorophenyl)Butyl)-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C14H21Cl2N |
| Molecular Weight | 274.23 |
| CAS Registry Number | 74039-41-1 |
| SMILES | [H+].C1=C(Cl)C=CC=C1C(N2CCCC2)CCC.[Cl-] |
| InChI | 1S/C14H20ClN.ClH/c1-2-6-14(16-9-3-4-10-16)12-7-5-8-13(15)11-12;/h5,7-8,11,14H,2-4,6,9-10H2,1H3;1H |
| InChIKey | MCMVNZDCZXHWAJ-UHFFFAOYSA-N |
| Boiling point | 297.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 133.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[1-(3-Chlorophenyl)Butyl]Pyrrolidine Hydrochloride |