|
CAS#: 74309-55-0 Product: 2-[1-(2-Chlorophenyl)Ethenyl]-Pyridine No suppilers available for the product. |
| Name | 2-[1-(2-Chlorophenyl)Ethenyl]-Pyridine |
|---|---|
| Synonyms | 2-[1-(2-Chlorophenyl)Vinyl]Pyridine; Pyridine,2-[1-(2-Chlorophenyl)Ethenyl]-; Pyridine, 2-(1-(2-Chlorophenyl)Ethenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10ClN |
| Molecular Weight | 215.68 |
| CAS Registry Number | 74309-55-0 |
| SMILES | C1=CC=C(C(=C1)Cl)C(C2=NC=CC=C2)=C |
| InChI | 1S/C13H10ClN/c1-10(13-8-4-5-9-15-13)11-6-2-3-7-12(11)14/h2-9H,1H2 |
| InChIKey | BLHXHLXLRDYKJM-UHFFFAOYSA-N |
| Density | 1.153g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.875°C at 760 mmHg (Cal.) |
| Flash point | 179.42°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[1-(2-Chlorophenyl)Ethenyl]-Pyridine |