|
CAS#: 74332-78-8 Product: 1-[1-(4-Methoxyphenyl)Propyl]Pyrrolidine Hydrochloride No suppilers available for the product. |
| Name | 1-[1-(4-Methoxyphenyl)Propyl]Pyrrolidine Hydrochloride |
|---|---|
| Synonyms | H 116; Pyrrolidine, 1-(Alpha-Ethyl-P-Methoxybenzyl)-, Hydrochloride; 1-(1-(P-Methoxyphenyl)Propyl)Pyrrolidine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22ClNO |
| Molecular Weight | 255.79 |
| CAS Registry Number | 74332-78-8 |
| SMILES | [H+].C2=C(C(N1CCCC1)CC)C=CC(=C2)OC.[Cl-] |
| InChI | 1S/C14H21NO.ClH/c1-3-14(15-10-4-5-11-15)12-6-8-13(16-2)9-7-12;/h6-9,14H,3-5,10-11H2,1-2H3;1H |
| InChIKey | KLUWQRZHOZROLM-UHFFFAOYSA-N |
| Boiling point | 299.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 88.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[1-(4-Methoxyphenyl)Propyl]Pyrrolidine Hydrochloride |