|
CAS#: 74417-11-1 Product: 5-(3-Chlorophenyl)-3-(Phenoxy)-1,2,4-Triazine No suppilers available for the product. |
| Name | 5-(3-Chlorophenyl)-3-(Phenoxy)-1,2,4-Triazine |
|---|---|
| Synonyms | 1,2,4-Triazine, 5-(3-Chlorophenyl)-3-Phenoxy-; 5-(M-Chlorophenyl)-3-Phenoxy-As-Triazine; As-Triazine, 5-(M-Chlorophenyl)-3-Phenoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10ClN3O |
| Molecular Weight | 283.72 |
| CAS Registry Number | 74417-11-1 |
| SMILES | C1=C(N=C(N=N1)OC2=CC=CC=C2)C3=CC=CC(=C3)Cl |
| InChI | 1S/C15H10ClN3O/c16-12-6-4-5-11(9-12)14-10-17-19-15(18-14)20-13-7-2-1-3-8-13/h1-10H |
| InChIKey | KNTIYTJJGBYJHI-UHFFFAOYSA-N |
| Density | 1.308g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.383°C at 760 mmHg (Cal.) |
| Flash point | 242.513°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(3-Chlorophenyl)-3-(Phenoxy)-1,2,4-Triazine |