| Name | 2-(1,3-Dithiolan-2-Ylidene)-1-Phenylbutane-1,3-Dione |
|---|---|
| Synonyms | 2-(1,3-Dithiolan-2-Ylidene)-1-Phenyl-Butane-1,3-Dione; 2-(1,3-Dithiolan-2-Ylidene)-1-Phenyl-1,3-Butanedione; Kz 1026 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12O2S2 |
| Molecular Weight | 264.36 |
| CAS Registry Number | 74440-20-3 |
| SMILES | C1=CC=CC=C1C(C(C(C)=O)=C2SCCS2)=O |
| InChI | 1S/C13H12O2S2/c1-9(14)11(13-16-7-8-17-13)12(15)10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| InChIKey | JZPYFWUDLGQTDS-UHFFFAOYSA-N |
| Density | 1.305g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.101°C at 760 mmHg (Cal.) |
| Flash point | 183.553°C (Cal.) |
| (1) | Lan-Cui Zhang, Na Li, Xiao-Hui Li, Cui-Ying Huang and Guang-Hua Zhou . 2-(1,3-Dithian-2-ylidene)-1-phenylbutane-1,3-dione , Acta Cryst (2008). E64, o534Â Â |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(1,3-Dithiolan-2-Ylidene)-1-Phenylbutane-1,3-Dione |