|
CAS#: 74672-05-2 Product: 1-Methoxy-4-(4-methyl-4-penten-2-yl)benzene No suppilers available for the product. |
| Name | 1-Methoxy-4-(4-methyl-4-penten-2-yl)benzene |
|---|---|
| Synonyms | 4-(1,3-Dimethyl-3-butenyl)phenyl methyl ether # |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28 |
| CAS Registry Number | 74672-05-2 |
| SMILES | O(c1ccc(cc1)C(CC(=C)\C)C)C |
| InChI | 1S/C13H18O/c1-10(2)9-11(3)12-5-7-13(14-4)8-6-12/h5-8,11H,1,9H2,2-4H3 |
| InChIKey | NMGUXPZHIVMNPW-UHFFFAOYSA-N |
| Density | 0.915g/cm3 (Cal.) |
|---|---|
| Boiling point | 258.204°C at 760 mmHg (Cal.) |
| Flash point | 97.723°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methoxy-4-(4-methyl-4-penten-2-yl)benzene |