|
CAS#: 7470-20-4 Product: (E)-3-Phenanthren-2-Ylprop-2-Enoic Acid No suppilers available for the product. |
| Name | (E)-3-Phenanthren-2-Ylprop-2-Enoic Acid |
|---|---|
| Synonyms | 3-Phenanthren-2-Ylprop-2-Enoic Acid; (E)-3-(2-Phenanthryl)Prop-2-Enoic Acid; 3-(2-Phenanthryl)Prop-2-Enoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C17H12O2 |
| Molecular Weight | 248.28 |
| CAS Registry Number | 7470-20-4 |
| SMILES | C1=CC2=C(C=C1\C=C\C(O)=O)C=CC3=C2C=CC=C3 |
| InChI | 1S/C17H12O2/c18-17(19)10-6-12-5-9-16-14(11-12)8-7-13-3-1-2-4-15(13)16/h1-11H,(H,18,19)/b10-6+ |
| InChIKey | YEEMGQYDLFLFDX-UXBLZVDNSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.37°C at 760 mmHg (Cal.) |
| Flash point | 371.032°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-3-Phenanthren-2-Ylprop-2-Enoic Acid |