|
CAS#: 7494-63-5 Product: 5,7-Dichloro-3-(2-Phenylhydrazinyl)Indol-2-One No suppilers available for the product. |
| Name | 5,7-Dichloro-3-(2-Phenylhydrazinyl)Indol-2-One |
|---|---|
| Synonyms | 5,7-Dichloro-3-(N'-Phenylhydrazino)Indol-2-One; 5,7-Dichloro-3-(N'-Phenylhydrazino)-2-Indolone; Nsc402464 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9Cl2N3O |
| Molecular Weight | 306.15 |
| CAS Registry Number | 7494-63-5 |
| SMILES | C3=C(NNC1=C2C(=NC1=O)C(=CC(=C2)Cl)Cl)C=CC=C3 |
| InChI | 1S/C14H9Cl2N3O/c15-8-6-10-12(11(16)7-8)17-14(20)13(10)19-18-9-4-2-1-3-5-9/h1-7,18H,(H,17,19,20) |
| InChIKey | KCHMXHQFWYBGCR-UHFFFAOYSA-N |
| Density | 1.512g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.363°C at 760 mmHg (Cal.) |
| Flash point | 161.461°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,7-Dichloro-3-(2-Phenylhydrazinyl)Indol-2-One |