|
CAS#: 7508-76-1 Product: 2,8-Quinolinediamine No suppilers available for the product. |
| Name | 2,8-Quinolinediamine |
|---|---|
| Synonyms | (2-Amino-8-Quinolyl)Amine; Nsc404778 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 |
| CAS Registry Number | 7508-76-1 |
| SMILES | C2=C(N)C1=C(C=CC(=N1)N)C=C2 |
| InChI | 1S/C9H9N3/c10-7-3-1-2-6-4-5-8(11)12-9(6)7/h1-5H,10H2,(H2,11,12) |
| InChIKey | OGFWMRDQOJXAGW-UHFFFAOYSA-N |
| Density | 1.312g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.928°C at 760 mmHg (Cal.) |
| Flash point | 216.764°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,8-Quinolinediamine |