|
CAS#: 75348-50-4 Product: 1-(4-Chlorophenyl)Propylhydrazine Hydrochloride No suppilers available for the product. |
| Name | 1-(4-Chlorophenyl)Propylhydrazine Hydrochloride |
|---|---|
| Synonyms | (P-Chloro-Alpha-Ethylbenzyl)Hydrazine Hydrochloride; Hydrazine, (P-Chloro-Alpha-Ethylbenzyl)-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14Cl2N2 |
| Molecular Weight | 221.13 |
| CAS Registry Number | 75348-50-4 |
| SMILES | [H+].C1=C(C(NN)CC)C=CC(=C1)Cl.[Cl-] |
| InChI | 1S/C9H13ClN2.ClH/c1-2-9(12-11)7-3-5-8(10)6-4-7;/h3-6,9,12H,2,11H2,1H3;1H |
| InChIKey | KORAXYICOMHTGO-UHFFFAOYSA-N |
| Boiling point | 315.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 144.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Chlorophenyl)Propylhydrazine Hydrochloride |