|
CAS#: 755-13-5 Product: 4,6,7-Trichloro-1,1,2,3,3,4,5,5,6,7,7-Undecafluoro-Hept-1-Ene No suppilers available for the product. |
| Name | 4,6,7-Trichloro-1,1,2,3,3,4,5,5,6,7,7-Undecafluoro-Hept-1-Ene |
|---|---|
| Synonyms | 4,6,7-Trichloro-1,1,2,3,3,4,5,5,6,7,7-Undecafluoro-Hept-1-Ene; Nsc3367 |
| Molecular Structure | ![]() |
| Molecular Formula | C7Cl3F11 |
| Molecular Weight | 399.42 |
| CAS Registry Number | 755-13-5 |
| SMILES | C(=C(F)C(F)(C(Cl)(F)C(F)(F)C(C(F)(Cl)F)(Cl)F)F)(F)F |
| InChI | 1S/C7Cl3F11/c8-4(16,3(14,15)1(11)2(12)13)6(18,19)5(9,17)7(10,20)21 |
| InChIKey | OPNJDWSPEUABTI-UHFFFAOYSA-N |
| Density | 1.724g/cm3 (Cal.) |
|---|---|
| Boiling point | 193.41°C at 760 mmHg (Cal.) |
| Flash point | 95.074°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6,7-Trichloro-1,1,2,3,3,4,5,5,6,7,7-Undecafluoro-Hept-1-Ene |