|
CAS#: 75523-08-9 Product: 6,8-Dimethoxy-2-Phenylchromen-4-One No suppilers available for the product. |
| Name | 6,8-Dimethoxy-2-Phenylchromen-4-One |
|---|---|
| Synonyms | 6,8-Dimethoxy-2-Phenyl-Chromen-4-One; 6,8-Dimethoxy-2-Phenyl-4-Chromenone; 6,8-Dimethoxy-2-Phenyl-Chromone |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 |
| CAS Registry Number | 75523-08-9 |
| SMILES | C1=C2C(=C(OC)C=C1OC)OC(=CC2=O)C3=CC=CC=C3 |
| InChI | 1S/C17H14O4/c1-19-12-8-13-14(18)10-15(11-6-4-3-5-7-11)21-17(13)16(9-12)20-2/h3-10H,1-2H3 |
| InChIKey | ZDKKBYGKYAQKAS-UHFFFAOYSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.575°C at 760 mmHg (Cal.) |
| Flash point | 213.444°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,8-Dimethoxy-2-Phenylchromen-4-One |