|
CAS#: 75503-13-8 Product: 3,3,6,6-Tetramethyl-5-Sulfanylidenebicyclo[2.2.1]Heptan-2-One No suppilers available for the product. |
| Name | 3,3,6,6-Tetramethyl-5-Sulfanylidenebicyclo[2.2.1]Heptan-2-One |
|---|---|
| Synonyms | 3,3,6,6-Tetramethyl-5-Thioxo-Norbornan-2-One; 3,3,6,6-Tetramethyl-5-Thioxo-2-Norbornanone; 3,3,6,6-Tetramethyl-5-Sulfanylidene-Bicyclo[2.2.1]Heptan-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16OS |
| Molecular Weight | 196.31 |
| CAS Registry Number | 75503-13-8 |
| SMILES | CC1(C2C(=O)C(C(C1=S)C2)(C)C)C |
| InChI | 1S/C11H16OS/c1-10(2)7-5-6(8(10)12)11(3,4)9(7)13/h6-7H,5H2,1-4H3 |
| InChIKey | CZRRUXOKFFFXRM-UHFFFAOYSA-N |
| Density | 1.107g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.134°C at 760 mmHg (Cal.) |
| Flash point | 118.382°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,6,6-Tetramethyl-5-Sulfanylidenebicyclo[2.2.1]Heptan-2-One |