|
CAS#: 75512-00-4 Product: 2-(Phenylamino)-10H-Acridin-9-One No suppilers available for the product. |
| Name | 2-(Phenylamino)-10H-Acridin-9-One |
|---|---|
| Synonyms | 2-(Phenylamino)Acridin-9(10H)-One; 9(10H)-Acridinone, 2-(Phenylamino)- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H14N2O |
| Molecular Weight | 286.33 |
| CAS Registry Number | 75512-00-4 |
| EINECS | 278-231-3 |
| SMILES | C2=C(NC1=CC=CC=C1)C=CC3=C2C(=O)C4=C(N3)C=CC=C4 |
| InChI | 1S/C19H14N2O/c22-19-15-8-4-5-9-17(15)21-18-11-10-14(12-16(18)19)20-13-6-2-1-3-7-13/h1-12,20H,(H,21,22) |
| InChIKey | USTNFRALPDIXCN-UHFFFAOYSA-N |
| Density | 1.275g/cm3 (Cal.) |
|---|---|
| Boiling point | 490.304°C at 760 mmHg (Cal.) |
| Flash point | 186.391°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Phenylamino)-10H-Acridin-9-One |