|
CAS#: 756-76-3 Product: Trichloro[3-(1,1,2,2-Tetrafluoroethoxy)Propyl]Silane No suppilers available for the product. |
| Name | Trichloro[3-(1,1,2,2-Tetrafluoroethoxy)Propyl]Silane |
|---|---|
| Synonyms | Trichloro(3-(1,1,2,2-Tetrafluoroethoxy)Propyl)Silane |
| Molecular Structure | ![]() |
| Molecular Formula | C5H7Cl3F4OSi |
| Molecular Weight | 293.55 |
| CAS Registry Number | 756-76-3 |
| EINECS | 212-051-8 |
| SMILES | C([Si](Cl)(Cl)Cl)CCOC(C(F)F)(F)F |
| InChI | 1S/C5H7Cl3F4OSi/c6-14(7,8)3-1-2-13-5(11,12)4(9)10/h4H,1-3H2 |
| InChIKey | WSQVRKHADNPCBM-UHFFFAOYSA-N |
| Density | 1.401g/cm3 (Cal.) |
|---|---|
| Boiling point | 207.652°C at 760 mmHg (Cal.) |
| Flash point | 79.385°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trichloro[3-(1,1,2,2-Tetrafluoroethoxy)Propyl]Silane |