|
CAS#: 75852-44-7 Product: 2-[3-Acetamido-5-(4-Methoxyphenyl)Phenyl]Acetic Acid No suppilers available for the product. |
| Name | 2-[3-Acetamido-5-(4-Methoxyphenyl)Phenyl]Acetic Acid |
|---|---|
| Synonyms | 2-[3-Acetamido-5-(4-Methoxyphenyl)Phenyl]Ethanoic Acid; Brn 5081387; (1,1'-Biphenyl)-3-Acetic Acid, 5-(Acetylamino)-4'-Methoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 |
| CAS Registry Number | 75852-44-7 |
| SMILES | C1=C(C=C(C=C1C2=CC=C(C=C2)OC)NC(=O)C)CC(=O)O |
| InChI | 1S/C17H17NO4/c1-11(19)18-15-8-12(9-17(20)21)7-14(10-15)13-3-5-16(22-2)6-4-13/h3-8,10H,9H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | KYXVPXHHLDZSDH-UHFFFAOYSA-N |
| Density | 1.251g/cm3 (Cal.) |
|---|---|
| Boiling point | 557.146°C at 760 mmHg (Cal.) |
| Flash point | 290.752°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[3-Acetamido-5-(4-Methoxyphenyl)Phenyl]Acetic Acid |