|
CAS#: 75852-51-6 Product: 2-(3-Chloro-5-Phenylphenyl)Acetic Acid No suppilers available for the product. |
| Name | 2-(3-Chloro-5-Phenylphenyl)Acetic Acid |
|---|---|
| Synonyms | 2-(3-Chloro-5-Phenyl-Phenyl)Acetic Acid; 2-(3-Chloro-5-Phenyl-Phenyl)Ethanoic Acid; 3-Biphenylacetic Acid, 5-Chloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11ClO2 |
| Molecular Weight | 246.69 |
| CAS Registry Number | 75852-51-6 |
| SMILES | C1=C(C=C(C=C1C2=CC=CC=C2)Cl)CC(O)=O |
| InChI | 1S/C14H11ClO2/c15-13-7-10(8-14(16)17)6-12(9-13)11-4-2-1-3-5-11/h1-7,9H,8H2,(H,16,17) |
| InChIKey | RZLRSTFBXAMFJV-UHFFFAOYSA-N |
| Density | 1.271g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.703°C at 760 mmHg (Cal.) |
| Flash point | 202.186°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Chloro-5-Phenylphenyl)Acetic Acid |