|
CAS#: 7597-47-9 Product: Methyl 3-(4-Nitrophenyl)Sulfanylpropanoate No suppilers available for the product. |
| Name | Methyl 3-(4-Nitrophenyl)Sulfanylpropanoate |
|---|---|
| Synonyms | 3-[(4-Nitrophenyl)Thio]Propanoic Acid Methyl Ester; 3-[(4-Nitrophenyl)Thio]Propionic Acid Methyl Ester; Nsc56881 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11NO4S |
| Molecular Weight | 241.26 |
| CAS Registry Number | 7597-47-9 |
| SMILES | C1=C(C=CC(=C1)[N+]([O-])=O)SCCC(OC)=O |
| InChI | 1S/C10H11NO4S/c1-15-10(12)6-7-16-9-4-2-8(3-5-9)11(13)14/h2-5H,6-7H2,1H3 |
| InChIKey | SNRGBLHQKWCUHS-UHFFFAOYSA-N |
| Density | 1.304g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.828°C at 760 mmHg (Cal.) |
| Flash point | 183.514°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3-(4-Nitrophenyl)Sulfanylpropanoate |