|
CAS#: 76386-25-9 Product: [(2E,6E)-3,7,11-Trimethyldodeca-2,6,10-Trienyl] N,N-Di(Phenyl)Carbamate No suppilers available for the product. |
| Name | [(2E,6E)-3,7,11-Trimethyldodeca-2,6,10-Trienyl] N,N-Di(Phenyl)Carbamate |
|---|---|
| Synonyms | 3,7,11-Trimethyldodeca-2,6,10-Trienyl N,N-Di(Phenyl)Carbamate; N,N-Di(Phenyl)Carbamic Acid [(2E,6E)-3,7,11-Trimethyldodeca-2,6,10-Trienyl] Ester; N,N-Di(Phenyl)Carbamic Acid 3,7,11-Trimethyldodeca-2,6,10-Trienyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C28H35NO2 |
| Molecular Weight | 417.59 |
| CAS Registry Number | 76386-25-9 |
| SMILES | C2=C(N(C1=CC=CC=C1)C(OC\C=C(\CC\C=C(\CCC=C(C)C)C)C)=O)C=CC=C2 |
| InChI | 1S/C28H35NO2/c1-23(2)13-11-14-24(3)15-12-16-25(4)21-22-31-28(30)29(26-17-7-5-8-18-26)27-19-9-6-10-20-27/h5-10,13,15,17-21H,11-12,14,16,22H2,1-4H3/b24-15+,25-21+ |
| InChIKey | JVKHLVYHRZTVCF-GFUUNDCYSA-N |
| Density | 1.03g/cm3 (Cal.) |
|---|---|
| Boiling point | 538.548°C at 760 mmHg (Cal.) |
| Flash point | 279.504°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(2E,6E)-3,7,11-Trimethyldodeca-2,6,10-Trienyl] N,N-Di(Phenyl)Carbamate |