Online Database of Chemicals from Around the World
|
CAS#: 76608-49-6 Product: (Z)-1-Cyclohexyl-4,4-Dimethyl-2-(1,2,4-Triazol-1-Yl)Pent-1-En-3-Ol No suppilers available for the product. |
| Name | (Z)-1-Cyclohexyl-4,4-Dimethyl-2-(1,2,4-Triazol-1-Yl)Pent-1-En-3-Ol |
|---|---|
| Synonyms | Alpha-Tert-Butyl-Beta-(Cyclohexylmethylene)-1H-1,2,4-Triazol-1-Ethanol |
| Molecular Structure |  |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 |
| CAS Registry Number | 76608-49-6 |
| EINECS | 278-497-0 |
| SMILES | C1=N[N](C=N1)C(/C(O)C(C)(C)C)=C\C2CCCCC2 |
| InChI | 1S/C15H25N3O/c1-15(2,3)14(19)13(18-11-16-10-17-18)9-12-7-5-4-6-8-12/h9-12,14,19H,4-8H2,1-3H3/b13-9- |
| InChIKey | CNFMJLVJDNGPHR-LCYFTJDESA-N |
| Density | 1.11g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.227°C at 760 mmHg (Cal.) |
| Flash point | 207.946°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z)-1-Cyclohexyl-4,4-Dimethyl-2-(1,2,4-Triazol-1-Yl)Pent-1-En-3-Ol |