|
CAS#: 773-55-7 Product: 2-Methyl-2-(p-Tolyl)Thiazolidine No suppilers available for the product. |
| Name | 2-Methyl-2-(p-Tolyl)Thiazolidine |
|---|---|
| Synonyms | 2-Methyl-2-(4-Methylphenyl)Thiazolidine; 2-(P-Methylphenyl)-2-Methylthiazolidine; 2-(P-Tolyl)-2-Methylthiazolidine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 |
| CAS Registry Number | 773-55-7 |
| SMILES | C2=C(C1(SCCN1)C)C=CC(=C2)C |
| InChI | 1S/C11H15NS/c1-9-3-5-10(6-4-9)11(2)12-7-8-13-11/h3-6,12H,7-8H2,1-2H3 |
| InChIKey | GFMLJKIPRVCWSE-UHFFFAOYSA-N |
| Density | 1.056g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.498°C at 760 mmHg (Cal.) |
| Flash point | 145.213°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-(p-Tolyl)Thiazolidine |