|
CAS#: 77594-94-6 Product: 3-(2-Chloro-5-Nitrophenyl)-1-(3-Hydroxypropyl)Thiourea No suppilers available for the product. |
| Name | 3-(2-Chloro-5-Nitrophenyl)-1-(3-Hydroxypropyl)Thiourea |
|---|---|
| Synonyms | 3-(2-Chloro-5-Nitro-Phenyl)-1-(3-Hydroxypropyl)Thiourea; 1-(2-Chloro-5-Nitrophenyl)-3-(3-Hydroxypropyl)Thiourea |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12ClN3O3S |
| Molecular Weight | 289.74 |
| CAS Registry Number | 77594-94-6 |
| EINECS | 278-730-6 |
| SMILES | C1=C([N+]([O-])=O)C=CC(=C1NC(=S)NCCCO)Cl |
| InChI | 1S/C10H12ClN3O3S/c11-8-3-2-7(14(16)17)6-9(8)13-10(18)12-4-1-5-15/h2-3,6,15H,1,4-5H2,(H2,12,13,18) |
| InChIKey | FCAWDKNIWLFMLN-UHFFFAOYSA-N |
| Density | 1.497g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.698°C at 760 mmHg (Cal.) |
| Flash point | 216.093°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Chloro-5-Nitrophenyl)-1-(3-Hydroxypropyl)Thiourea |