Online Database of Chemicals from Around the World
|
CAS#: 77694-34-9 Product: 4-Bromo-N-(2-Oxooxolan-3-Yl)Benzamide No suppilers available for the product. |
| Name | 4-Bromo-N-(2-Oxooxolan-3-Yl)Benzamide |
|---|---|
| Synonyms | 4-Bromo-N-(2-Oxotetrahydrofuran-3-Yl)Benzamide; 4-Bromo-N-(2-Oxo-3-Tetrahydrofuranyl)Benzamide; 4-Bromo-N-(2-Ketotetrahydrofuran-3-Yl)Benzamide |
| Molecular Structure |  |
| Molecular Formula | C11H10BrNO3 |
| Molecular Weight | 284.11 |
| CAS Registry Number | 77694-34-9 |
| SMILES | C1=CC(=CC=C1C(NC2C(OCC2)=O)=O)Br |
| InChI | 1S/C11H10BrNO3/c12-8-3-1-7(2-4-8)10(14)13-9-5-6-16-11(9)15/h1-4,9H,5-6H2,(H,13,14) |
| InChIKey | FKBDDIATWGVLAF-UHFFFAOYSA-N |
| Density | 1.621g/cm3 (Cal.) |
|---|---|
| Boiling point | 513.095°C at 760 mmHg (Cal.) |
| Flash point | 264.111°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bromo-N-(2-Oxooxolan-3-Yl)Benzamide |