|
CAS#: 7773-73-1 Product: 2,2'-[Methylenebis(p-Phenylene)]Bis(Guanidine) No suppilers available for the product. |
| Name | 2,2'-[Methylenebis(p-Phenylene)]Bis(Guanidine) |
|---|---|
| Synonyms | 2-[4-[(4-Guanidinophenyl)Methyl]Phenyl]Guanidine; 2-[4-(4-Guanidinobenzyl)Phenyl]Guanidine; Aids-166969 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18N6 |
| Molecular Weight | 282.35 |
| CAS Registry Number | 7773-73-1 |
| SMILES | C2=C(CC1=CC=C(N=C(N)N)C=C1)C=CC(=C2)N=C(N)N |
| InChI | 1S/C15H18N6/c16-14(17)20-12-5-1-10(2-6-12)9-11-3-7-13(8-4-11)21-15(18)19/h1-8H,9H2,(H4,16,17,20)(H4,18,19,21) |
| InChIKey | VPFQDYYIEBRWAW-UHFFFAOYSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 562.812°C at 760 mmHg (Cal.) |
| Flash point | 294.178°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-[Methylenebis(p-Phenylene)]Bis(Guanidine) |