|
CAS#: 78150-04-6 Product: Methyl 2,5-Dichlorobenzenesulfonate No suppilers available for the product. |
| Name | Methyl 2,5-Dichlorobenzenesulfonate |
|---|---|
| Synonyms | 2,5-Dichlorobenzenesulfonic Acid Methyl Ester; Benzenesulfonic Acid, 2,5-Dichloro-, Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6Cl2O3S |
| Molecular Weight | 241.09 |
| CAS Registry Number | 78150-04-6 |
| EINECS | 278-851-4 |
| SMILES | C1=C(Cl)C=CC(=C1[S](OC)(=O)=O)Cl |
| InChI | 1S/C7H6Cl2O3S/c1-12-13(10,11)7-4-5(8)2-3-6(7)9/h2-4H,1H3 |
| InChIKey | LPOZFGQJZQYOBJ-UHFFFAOYSA-N |
| Density | 1.493g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.855°C at 760 mmHg (Cal.) |
| Flash point | 161.153°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2,5-Dichlorobenzenesulfonate |