|
CAS#: 78987-68-5 Product: 3-Phenylpropyl 2,2,2-Trichloroacetate No suppilers available for the product. |
| Name | 3-Phenylpropyl 2,2,2-Trichloroacetate |
|---|---|
| Synonyms | 2,2,2-Trichloroacetic Acid 3-Phenylpropyl Ester; 3-Phenylpropyl 2,2,2-Trichloroethanoate; Nsc6019 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11Cl3O2 |
| Molecular Weight | 281.57 |
| CAS Registry Number | 78987-68-5 |
| SMILES | C1=CC=CC=C1CCCOC(C(Cl)(Cl)Cl)=O |
| InChI | 1S/C11H11Cl3O2/c12-11(13,14)10(15)16-8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| InChIKey | SYGLRTZHJMHHSD-UHFFFAOYSA-N |
| Density | 1.344g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.825°C at 760 mmHg (Cal.) |
| Flash point | 131.904°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Phenylpropyl 2,2,2-Trichloroacetate |