|
CAS#: 79357-66-7 Product: Buta-1,3-Diene; Ethenylbenzene No suppilers available for the product. |
| Name | Buta-1,3-Diene; Ethenylbenzene |
|---|---|
| Synonyms | Buta-1,3-Diene; Vinylbenzene; Butadiene-Styrene Copolymer; Butadiene-Styrene Polymer |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 |
| CAS Registry Number | 79357-66-7 (9003-55-8;91261-65-3;81406-92-0;68584-03-2) |
| SMILES | C1=C(C=CC=C1)C=C.C(C=C)=C |
| InChI | 1S/C8H8.C4H6/c1-2-8-6-4-3-5-7-8;1-3-4-2/h2-7H,1H2;3-4H,1-2H2 |
| InChIKey | MTAZNLWOLGHBHU-UHFFFAOYSA-N |
| Boiling point | 145.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 31.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Buta-1,3-Diene; Ethenylbenzene |