|
CAS#: 794461-82-8 Product: Methyl 2-(trifluoromethyl)-5,6,7,8-tetrahydro-1,6-naphthyridine-3-carboxylate No suppilers available for the product. |
| Name | Methyl 2-(trifluoromethyl)-5,6,7,8-tetrahydro-1,6-naphthyridine-3-carboxylate |
|---|---|
| Synonyms | 1,6-Napht |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11F3N2O2 |
| Molecular Weight | 260.21 |
| CAS Registry Number | 794461-82-8 |
| SMILES | COC(=O)c1cc2c(nc1C(F)(F)F)CCNC2 |
| InChI | 1S/C11H11F3N2O2/c1-18-10(17)7-4-6-5-15-3-2-8(6)16-9(7)11(12,13)14/h4,15H,2-3,5H2,1H3 |
| InChIKey | ROHRKMIUPOLEBP-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.9±42.0°C at 760 mmHg (Cal.) |
| Flash point | 151.5±27.9°C (Cal.) |
| Refractive index | 1.487 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-(trifluoromethyl)-5,6,7,8-tetrahydro-1,6-naphthyridine-3-carboxylate |