Online Database of Chemicals from Around the World
|
CAS#: 799-13-3 Product: 4-tert-Butyl-2-(5-tert-butyl-2-hydroxy-benzyl)phenol No suppilers available for the product. |
| Name | 4-tert-Butyl-2-(5-tert-butyl-2-hydroxy-benzyl)phenol |
|---|---|
| Synonyms | 4-Tert-Butyl-2-[(5-Tert-Butyl-2-Hydroxy-Phenyl)Methyl]Phenol; 4-Tert-Butyl-2-(5-Tert-Butyl-2-Hydroxy-Benzyl)Phenol; Nsc48161 |
| Molecular Structure |  |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 |
| CAS Registry Number | 799-13-3 |
| SMILES | C1=CC(=CC(=C1O)CC2=C(O)C=CC(=C2)C(C)(C)C)C(C)(C)C |
| InChI | 1S/C21H28O2/c1-20(2,3)16-7-9-18(22)14(12-16)11-15-13-17(21(4,5)6)8-10-19(15)23/h7-10,12-13,22-23H,11H2,1-6H3 |
| InChIKey | RXAGDDKHRDAVLM-UHFFFAOYSA-N |
| Density | 1.045g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.618°C at 760 mmHg (Cal.) |
| Flash point | 191.263°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-tert-Butyl-2-(5-tert-butyl-2-hydroxy-benzyl)phenol |