|
CAS#: 80251-34-9 Product: 4-Amidino-2-Benzoylphenyl 4-Guanidinobenzoate Dimethanesulfonate No suppilers available for the product. |
| Name | 4-Amidino-2-Benzoylphenyl 4-Guanidinobenzoate Dimethanesulfonate |
|---|---|
| Synonyms | (2-Benzoyl-4-Carbamimidoyl-Phenyl) 4-Guanidinobenzoate; Methanesulfonic Acid; 4-Guanidinobenzoic Acid (2-Benzoyl-4-Carbamimidoylphenyl) Ester; Methanesulfonic Acid; 4-Guanidinobenzoic Acid (4-Amidino-2-Benzoyl-Phenyl) Ester; Methanesulfonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C24H27N5O9S2 |
| Molecular Weight | 593.63 |
| CAS Registry Number | 80251-34-9 |
| SMILES | C[S](O)(=O)=O.C[S](O)(=O)=O.C1=C(C=CC(=C1C(=O)C2=CC=CC=C2)OC(=O)C3=CC=C(N=C(N)N)C=C3)C(N)=N |
| InChI | 1S/C22H19N5O3.2CH4O3S/c23-20(24)15-8-11-18(17(12-15)19(28)13-4-2-1-3-5-13)30-21(29)14-6-9-16(10-7-14)27-22(25)26;2*1-5(2,3)4/h1-12H,(H3,23,24)(H4,25,26,27);2*1H3,(H,2,3,4) |
| InChIKey | MASNIQZTUDXGDC-UHFFFAOYSA-N |
| Boiling point | 697.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 375.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amidino-2-Benzoylphenyl 4-Guanidinobenzoate Dimethanesulfonate |