|
CAS#: 80267-67-0 Product: 6-Nitronaphthalene-1,4-Dione No suppilers available for the product. |
| Name | 6-Nitronaphthalene-1,4-Dione |
|---|---|
| Synonyms | 6-Nitro-1,4-Naphthoquinone; Nitronaphthoquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C10H5NO4 |
| Molecular Weight | 203.15 |
| CAS Registry Number | 80267-67-0 |
| SMILES | C1=C([N+]([O-])=O)C=CC2=C1C(=O)C=CC2=O |
| InChI | 1S/C10H5NO4/c12-9-3-4-10(13)8-5-6(11(14)15)1-2-7(8)9/h1-5H |
| InChIKey | XDIWXFTZTJQXDE-UHFFFAOYSA-N |
| Density | 1.512g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.286°C at 760 mmHg (Cal.) |
| Flash point | 223.916°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Nitronaphthalene-1,4-Dione |