|
CAS#: 80272-23-7 Product: 3-(4-Fluorophenyl)-6-Methylindan-1-One No suppilers available for the product. |
| Name | 3-(4-Fluorophenyl)-6-Methylindan-1-One |
|---|---|
| Synonyms | 3-(4-Fluorophenyl)-6-Methyl-Indan-1-One; 3-(4-Fluorophenyl)-6-Methyl-1-Indanone; 3-(4-Fluorophenyl)-6-Methylindan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13FO |
| Molecular Weight | 240.28 |
| CAS Registry Number | 80272-23-7 |
| EINECS | 279-436-0 |
| SMILES | C1=C(C=CC2=C1C(=O)CC2C3=CC=C(F)C=C3)C |
| InChI | 1S/C16H13FO/c1-10-2-7-13-14(9-16(18)15(13)8-10)11-3-5-12(17)6-4-11/h2-8,14H,9H2,1H3 |
| InChIKey | DMZGDJOWXYJRMX-UHFFFAOYSA-N |
| Density | 1.203g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.715°C at 760 mmHg (Cal.) |
| Flash point | 165.338°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Fluorophenyl)-6-Methylindan-1-One |