|
CAS#: 8031-72-9 Product: Cypripedin No suppilers available for the product. |
| Name | Cypripedin |
|---|---|
| Synonyms | 7-Hydroxy-2,8-Dimethoxy-Phenanthrene-1,4-Dione; 7-Hydroxy-2,8-Dimethoxy-Phenanthrene-1,4-Quinone; C10323 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 |
| CAS Registry Number | 8031-72-9 |
| SMILES | C1=C3C(=C2C(=C1)C(=C(C=C2)O)OC)C(C=C(OC)C3=O)=O |
| InChI | 1S/C16H12O5/c1-20-13-7-12(18)14-8-5-6-11(17)16(21-2)9(8)3-4-10(14)15(13)19/h3-7,17H,1-2H3 |
| InChIKey | BMYGDZTYQFCHKI-UHFFFAOYSA-N |
| Density | 1.427g/cm3 (Cal.) |
|---|---|
| Boiling point | 520.401°C at 760 mmHg (Cal.) |
| Flash point | 199.02°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cypripedin |