Online Database of Chemicals from Around the World
|
CAS#: 80446-23-7 Product: (+)-(1R,2S,3S,4R)-3,4-Dihydroxy-1,2-epoxy-1,2,3,4-tetrahydrobenz(a)anthracene No suppilers available for the product. |
| Name | (+)-(1R,2S,3S,4R)-3,4-Dihydroxy-1,2-epoxy-1,2,3,4-tetrahydrobenz(a)anthracene |
|---|---|
| Synonyms | Brn 4707052; Benz(A)Anthracene-3-Beta,4-Alpha-Diol, 1,2,3,4-Tetrahydro-1-Beta,2-Beta-Epoxy-, (+)- |
| Molecular Structure |  |
| Molecular Formula | C18H14O3 |
| Molecular Weight | 278.31 |
| CAS Registry Number | 80446-23-7 |
| SMILES | [C@H]4(C3=CC=C2C=C1C=CC=CC1=CC2=C3[C@@H]5[C@H]([C@H]4O)O5)O |
| InChI | 1S/C18H14O3/c19-15-12-6-5-11-7-9-3-1-2-4-10(9)8-13(11)14(12)17-18(21-17)16(15)20/h1-8,15-20H/t15-,16+,17-,18+/m1/s1 |
| InChIKey | JNQSJMYLVFOQBK-XDNAFOTISA-N |
| Density | 1.478g/cm3 (Cal.) |
|---|---|
| Boiling point | 567.46°C at 760 mmHg (Cal.) |
| Flash point | 296.99°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (+)-(1R,2S,3S,4R)-3,4-Dihydroxy-1,2-epoxy-1,2,3,4-tetrahydrobenz(a)anthracene |