|
CAS#: 8058-79-5 Product: Paraprost No suppilers available for the product. |
| Name | Paraprost |
|---|---|
| Synonyms | 2-Aminoacetic Acid; (2S)-2-Aminoglutaric Acid; (2S)-2-Aminopropionic Acid; 2-Aminoethanoic Acid; (2S)-2-Aminopentanedioic Acid; (2S)-2-Aminopropanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H21N3O8 |
| Molecular Weight | 311.29 |
| CAS Registry Number | 8058-79-5 |
| SMILES | [C@@H](N)(C(=O)O)CCC(=O)O.[C@@H](N)(C(=O)O)C.C(N)C(=O)O |
| InChI | 1S/C5H9NO4.C3H7NO2.C2H5NO2/c6-3(5(9)10)1-2-4(7)8;1-2(4)3(5)6;3-1-2(4)5/h3H,1-2,6H2,(H,7,8)(H,9,10);2H,4H2,1H3,(H,5,6);1,3H2,(H,4,5)/t3-;2-;/m00./s1 |
| InChIKey | RBPVKPJDVPPRMI-AVXONLMPSA-N |
| Boiling point | 333.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 155.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Paraprost |