|
CAS#: 80970-04-3 Product: N-(2-(Mercaptomethyl)-1-oxo-3-phenylpropyl)-L-Leucine No suppilers available for the product. |
| Name | N-(2-(Mercaptomethyl)-1-oxo-3-phenylpropyl)-L-Leucine |
|---|---|
| Synonyms | (2S)-4-Methyl-2-[[2-(Phenylmethyl)-3-Sulfanyl-Propanoyl]Amino]Pentanoic Acid; (2S)-2-[[2-(Mercaptomethyl)-1-Oxo-3-Phenylpropyl]Amino]-4-Methylpentanoic Acid; (2S)-2-[[2-(Benzyl)-3-Mercapto-Propanoyl]Amino]-4-Methyl-Valeric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.42 |
| CAS Registry Number | 80970-04-3 |
| SMILES | [C@H](C(=O)O)(NC(C(CC1=CC=CC=C1)CS)=O)CC(C)C |
| InChI | 1S/C16H23NO3S/c1-11(2)8-14(16(19)20)17-15(18)13(10-21)9-12-6-4-3-5-7-12/h3-7,11,13-14,21H,8-10H2,1-2H3,(H,17,18)(H,19,20)/t13?,14-/m0/s1 |
| InChIKey | PISCFNDSARITBO-KZUDCZAMSA-N |
| Density | 1.146g/cm3 (Cal.) |
|---|---|
| Boiling point | 533.958°C at 760 mmHg (Cal.) |
| Flash point | 276.728°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-(Mercaptomethyl)-1-oxo-3-phenylpropyl)-L-Leucine |