|
CAS#: 81344-25-4 Product: 4-Nitrophenyl (4-Chlorophenyl)Methylphosphinate No suppilers available for the product. |
| Name | 4-Nitrophenyl (4-Chlorophenyl)Methylphosphinate |
|---|---|
| Synonyms | 4-Nitrophenyl (4-Chlorophenyl)Methylphosphinate; Phosphinic Acid, (4-Chlorophenyl)Methyl-, 4-Nitrophenyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11ClNO4P |
| Molecular Weight | 311.66 |
| CAS Registry Number | 81344-25-4 |
| SMILES | C2=C([P](OC1=CC=C([N+]([O-])=O)C=C1)(=O)C)C=CC(=C2)Cl |
| InChI | 1S/C13H11ClNO4P/c1-20(18,13-8-2-10(14)3-9-13)19-12-6-4-11(5-7-12)15(16)17/h2-9H,1H3 |
| InChIKey | ORLKOTAMWPYNIJ-UHFFFAOYSA-N |
| Density | 1.407g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.396°C at 760 mmHg (Cal.) |
| Flash point | 218.935°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitrophenyl (4-Chlorophenyl)Methylphosphinate |