|
CAS#: 81252-14-4 Product: 6-Oxo-N-(2-oxotetrahydrothiophen-3-yl)-1H-pyridine-3-carboxamide No suppilers available for the product. |
| Name | 6-Oxo-N-(2-oxotetrahydrothiophen-3-yl)-1H-pyridine-3-carboxamide |
|---|---|
| Synonyms | 6-Oxo-N-(2-Oxotetrahydrothiophen-3-Yl)-1H-Pyridine-3-Carboxamide; 6-Oxo-N-(2-Oxo-3-Tetrahydrothiophenyl)-1H-Pyridine-3-Carboxamide; 6-Keto-N-(2-Ketotetrahydrothiophen-3-Yl)-1H-Pyridine-3-Carboxamide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.26 |
| CAS Registry Number | 81252-14-4 |
| SMILES | O=C(NC1C(SCC1)=O)C2=CNC(=O)C=C2 |
| InChI | 1S/C10H10N2O3S/c13-8-2-1-6(5-11-8)9(14)12-7-3-4-16-10(7)15/h1-2,5,7H,3-4H2,(H,11,13)(H,12,14) |
| InChIKey | DFLXDULNWLDAJO-UHFFFAOYSA-N |
| Density | 1.45g/cm3 (Cal.) |
|---|---|
| Boiling point | 622.53°C at 760 mmHg (Cal.) |
| Flash point | 330.294°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Oxo-N-(2-oxotetrahydrothiophen-3-yl)-1H-pyridine-3-carboxamide |