|
CAS#: 81292-80-0 Product: (5-Amino-3,4-dihydro-2H-pyrrol-2-ylidene)bisphosphonic acid No suppilers available for the product. |
| Name | (5-Amino-3,4-dihydro-2H-pyrrol-2-ylidene)bisphosphonic acid |
|---|---|
| Synonyms | (5-Amino-2-Phosphono-1-Pyrrolin-2-Yl)Phosphonic Acid; (5-Amino-3,4-Dihydro-2H-Pyrrol-2-Ylidene)Bisphosphonic Acid; 2-Iminopyrrolidone-5,5-Diphosphonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C4H10N2O6P2 |
| Molecular Weight | 244.08 |
| CAS Registry Number | 81292-80-0 |
| SMILES | O=[P](O)(O)C1([P](=O)(O)O)N=C(N)CC1 |
| InChI | 1S/C4H10N2O6P2/c5-3-1-2-4(6-3,13(7,8)9)14(10,11)12/h1-2H2,(H2,5,6)(H2,7,8,9)(H2,10,11,12) |
| InChIKey | XIGFQGFMDUSNIA-UHFFFAOYSA-N |
| Density | 2.442g/cm3 (Cal.) |
|---|---|
| Boiling point | 695.963°C at 760 mmHg (Cal.) |
| Flash point | 374.705°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5-Amino-3,4-dihydro-2H-pyrrol-2-ylidene)bisphosphonic acid |