|
CAS#: 81316-80-5 Product: 3-Nitrobenzo(k)Fluoranthene No suppilers available for the product. |
| Name | 3-Nitrobenzo(k)Fluoranthene |
|---|---|
| Synonyms | 3-Nitrobenzo(K)Fluoranthene; Benzo(K)Fluoranthene, 3-Nitro-; Ccris 5508 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H11NO2 |
| Molecular Weight | 297.31 |
| CAS Registry Number | 81316-80-5 |
| SMILES | C4=C3C2=C1C(=CC=CC1=C([N+]([O-])=O)C=C2)C3=CC5=CC=CC=C45 |
| InChI | 1S/C20H11NO2/c22-21(23)19-9-8-15-18-11-13-5-2-1-4-12(13)10-17(18)14-6-3-7-16(19)20(14)15/h1-11H |
| InChIKey | SOJSECJEJPKNFV-UHFFFAOYSA-N |
| Density | 1.43g/cm3 (Cal.) |
|---|---|
| Boiling point | 533.546°C at 760 mmHg (Cal.) |
| Flash point | 265.448°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Nitrobenzo(k)Fluoranthene |