|
CAS#: 81718-72-1 Product: N,N,3,5-Tetramethyl-2-Benzofurancarboxamide No suppilers available for the product. |
| Name | N,N,3,5-Tetramethyl-2-Benzofurancarboxamide |
|---|---|
| Synonyms | N,N,3,5-Tetramethylbenzofuran-2-Carboxamide; N,N,3,5-Tetramethyl-2-Benzofurancarboxamide; 2-Benzofurancarboxamide, N,N,3,5-Tetramethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 |
| CAS Registry Number | 81718-72-1 |
| SMILES | C2=C1C(=C(OC1=CC=C2C)C(=O)N(C)C)C |
| InChI | 1S/C13H15NO2/c1-8-5-6-11-10(7-8)9(2)12(16-11)13(15)14(3)4/h5-7H,1-4H3 |
| InChIKey | AAJPTEWWSJQKER-UHFFFAOYSA-N |
| Density | 1.119g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.739°C at 760 mmHg (Cal.) |
| Flash point | 179.226°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N,3,5-Tetramethyl-2-Benzofurancarboxamide |