|
CAS#: 81786-75-6 Product: 3,5,6,6-Tetramethyl-4-Methyleneheptan-2-One No suppilers available for the product. |
| Name | 3,5,6,6-Tetramethyl-4-Methyleneheptan-2-One |
|---|---|
| Synonyms | 3,5,6,6-Tetramethyl-4-Methylene-Heptan-2-One; 3,5,6,6-Tetramethyl-4-Methyleneheptan-2-One; 3-Methyl-4-(1,2,2-Trimethylpropyl)Pent-4-En-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 |
| CAS Registry Number | 81786-75-6 |
| EINECS | 279-825-5 |
| SMILES | CC(C(C(C(C(=O)C)C)=C)C)(C)C |
| InChI | 1S/C12H22O/c1-8(9(2)11(4)13)10(3)12(5,6)7/h9-10H,1H2,2-7H3 |
| InChIKey | FRUPGGSBENIUTJ-UHFFFAOYSA-N |
| Density | 0.831g/cm3 (Cal.) |
|---|---|
| Boiling point | 231.025°C at 760 mmHg (Cal.) |
| Flash point | 79.059°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5,6,6-Tetramethyl-4-Methyleneheptan-2-One |