|
CAS#: 81818-46-4 Product: 2,5-Dibromo-L-Tyrosine No suppilers available for the product. |
| Name | 2,5-Dibromo-L-Tyrosine |
|---|---|
| Synonyms | (2S)-2-Amino-3-(2,5-Dibromo-4-Hydroxy-Phenyl)Propanoic Acid; (2S)-2-Amino-3-(2,5-Dibromo-4-Hydroxy-Phenyl)Propionic Acid; 2,5-Dibromo-L-Tyrosine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9Br2NO3 |
| Molecular Weight | 338.98 |
| CAS Registry Number | 81818-46-4 |
| SMILES | [C@H](C(=O)O)(N)CC1=C(C=C(O)C(=C1)Br)Br |
| InChI | 1S/C9H9Br2NO3/c10-5-3-8(13)6(11)1-4(5)2-7(12)9(14)15/h1,3,7,13H,2,12H2,(H,14,15)/t7-/m0/s1 |
| InChIKey | CVLYJBHDGGDQSE-ZETCQYMHSA-N |
| Density | 2.015g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.585°C at 760 mmHg (Cal.) |
| Flash point | 220.863°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dibromo-L-Tyrosine |