|
CAS#: 82-77-9 Product: 1-[2-(1,1-Dimethylethyl)-4,6-Dimethylphenyl]Ethan-1-One No suppilers available for the product. |
| Name | 1-[2-(1,1-Dimethylethyl)-4,6-Dimethylphenyl]Ethan-1-One |
|---|---|
| Synonyms | 1-(2-Tert-Butyl-4,6-Dimethyl-Phenyl)Ethanone; 1-(2-(1,1-Dimethylethyl)-4,6-Dimethylphenyl)Ethan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 |
| CAS Registry Number | 82-77-9 |
| EINECS | 201-439-2 |
| SMILES | C1=C(C)C(=C(C=C1C)C(C)(C)C)C(=O)C |
| InChI | 1S/C14H20O/c1-9-7-10(2)13(11(3)15)12(8-9)14(4,5)6/h7-8H,1-6H3 |
| InChIKey | GSFYTAZYMJWICZ-UHFFFAOYSA-N |
| Density | 0.928g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.959°C at 760 mmHg (Cal.) |
| Flash point | 116.631°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[2-(1,1-Dimethylethyl)-4,6-Dimethylphenyl]Ethan-1-One |