|
CAS#: 82136-27-4 Product: 1-(2,4,6-Trifluorophenyl)-3,3-Dimethyltriazene No suppilers available for the product. |
| Name | 1-(2,4,6-Trifluorophenyl)-3,3-Dimethyltriazene |
|---|---|
| Synonyms | N-Methyl-N-(2,4,6-Trifluorophenyl)Azo-Methanamine; N-Methyl-N-(2,4,6-Trifluorophenyl)Azomethanamine; Dimethyl-(2,4,6-Trifluorophenyl)Azo-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8F3N3 |
| Molecular Weight | 203.17 |
| CAS Registry Number | 82136-27-4 |
| SMILES | C1=C(F)C=C(C(=C1F)N=NN(C)C)F |
| InChI | 1S/C8H8F3N3/c1-14(2)13-12-8-6(10)3-5(9)4-7(8)11/h3-4H,1-2H3 |
| InChIKey | BOTCREGAXGHOLG-UHFFFAOYSA-N |
| Density | 1.269g/cm3 (Cal.) |
|---|---|
| Boiling point | 212.722°C at 760 mmHg (Cal.) |
| Flash point | 82.452°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,4,6-Trifluorophenyl)-3,3-Dimethyltriazene |