|
CAS#: 82439-12-1 Product: 1-Methyl-4-(1-Propyl-3-Piperidinyl)-1H-Indole Ethanedioate (1:1) No suppilers available for the product. |
| Name | 1-Methyl-4-(1-Propyl-3-Piperidinyl)-1H-Indole Ethanedioate (1:1) |
|---|---|
| Synonyms | 1-Methyl-4-(1-Propyl-3-Piperidyl)Indole; Oxalic Acid; 1-Methyl-4-(1-Propyl-3-Piperidinyl)Indole; Oxalic Acid; Ethanedioic Acid; 1-Methyl-4-(1-Propylpiperidin-3-Yl)Indole |
| Molecular Structure | ![]() |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 |
| CAS Registry Number | 82439-12-1 |
| SMILES | O=C(O)C(=O)O.C1=C[N](C2=C1C(=CC=C2)C3CN(CCC3)CCC)C |
| InChI | 1S/C17H24N2.C2H2O4/c1-3-10-19-11-5-6-14(13-19)15-7-4-8-17-16(15)9-12-18(17)2;3-1(4)2(5)6/h4,7-9,12,14H,3,5-6,10-11,13H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | LGUYREWVHWOZLH-UHFFFAOYSA-N |
| Boiling point | 397.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 194.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-4-(1-Propyl-3-Piperidinyl)-1H-Indole Ethanedioate (1:1) |